C31H47NO5Si2 — CID 102127444
tert-butyl-[[(1R,2R,6S,11R,12R)-4,4-dimethyl-12-(2-trimethylsilylethoxy)-3,5,9-trioxa-8-azatricyclo[6.4.0.02,6]dodecan-11-yl]oxy]-diphenylsilane (PubChem CID 102127444) has the molecular formula C31H47NO5Si2 and a molecular weight of 569.89 g/mol. Its IUPAC name is tert-butyl-[[(1R,2R,6S,11R,12R)-4,4-dimethyl-12-(2-trimethylsilylethoxy)-3,5,9-trioxa-8-azatricyclo[6.4.0.02,6]dodecan-11-yl]oxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(1R,2R,6S,11R,12R)-4,4-dimethyl-12-(2-trimethylsilylethoxy)-3,5,9-trioxa-8-azatricyclo[6.4.0.02,6]dodecan-11-yl]oxy]-diphenylsilane |
|---|---|
| PubChem CID | 102127444 |
| Molecular Formula | C31H47NO5Si2 |
| Molecular Weight | 569.89 g/mol |
| Exact Mass | 569.30 |
| IUPAC Name | tert-butyl-[[(1R,2R,6S,11R,12R)-4,4-dimethyl-12-(2-trimethylsilylethoxy)-3,5,9-trioxa-8-azatricyclo[6.4.0.02,6]dodecan-11-yl]oxy]-diphenylsilane |
| SMILES | CC1(C)O[C@@H]2[C@H]3[C@@H](OCC[Si](C)(C)C)[C@H](O[Si](c4ccccc4)(c4ccccc4)C(C)(C)C)CON3C[C@@H]2O1 |
| InChI | InChI=1S/C31H47NO5Si2/c1-30(2,3)39(23-15-11-9-12-16-23,24-17-13-10-14-18-24)37-26-22-34-32-21-25-29(36-31(4,5)35-25)27(32)28(26)33-19-20-38(6,7)8/h9-18,25-29H,19-22H2,1-8H3/t25-,26+,27+,28-,29-/m0/s1 |
| InChIKey | DYHXWYQZRCQMRM-ZKZHHWRMSA-N |
| XLogP | 4.80 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.89 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|