C33H47NO6Si — CID 135028418
1-[(3aS,4R)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-6-yl]-3-[[tert-butyl(diphenyl)silyl]oxymethyl]but-3-en-2-ol (PubChem CID 135028418) has the molecular formula C33H47NO6Si and a molecular weight of 581.83 g/mol. Its IUPAC name is 1-[(3aS,4R)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-6-yl]-3-[[tert-butyl(diphenyl)silyl]oxymethyl]but-3-en-2-ol.
| Compound Name | 1-[(3aS,4R)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-6-yl]-3-[[tert-butyl(diphenyl)silyl]oxymethyl]but-3-en-2-ol |
|---|---|
| PubChem CID | 135028418 |
| Molecular Formula | C33H47NO6Si |
| Molecular Weight | 581.83 g/mol |
| Exact Mass | 581.32 |
| IUPAC Name | 1-[(3aS,4R)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyrrol-6-yl]-3-[[tert-butyl(diphenyl)silyl]oxymethyl]but-3-en-2-ol |
| SMILES | C=C(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(O)CC1N[C@H](C2COC(C)(C)O2)[C@@H]2OC(C)(C)OC12 |
| InChI | InChI=1S/C33H47NO6Si/c1-22(20-37-41(31(2,3)4,23-15-11-9-12-16-23)24-17-13-10-14-18-24)26(35)19-25-29-30(40-33(7,8)39-29)28(34-25)27-21-36-32(5,6)38-27/h9-18,25-30,34-35H,1,19-21H2,2-8H3/t25?,26?,27?,28-,29?,30+/m1/s1 |
| InChIKey | MURHFOZQMXZXRO-NTYPJXMKSA-N |
| XLogP | 3.88 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.83 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|