C16H26O2Si — CID 135028459
(3-methylcyclohex-2-en-1-yl) 2-methyl-5-trimethylsilylpent-4-ynoate (PubChem CID 135028459) has the molecular formula C16H26O2Si and a molecular weight of 278.47 g/mol. Its IUPAC name is (3-methylcyclohex-2-en-1-yl) 2-methyl-5-trimethylsilylpent-4-ynoate.
| Compound Name | (3-methylcyclohex-2-en-1-yl) 2-methyl-5-trimethylsilylpent-4-ynoate |
|---|---|
| PubChem CID | 135028459 |
| Molecular Formula | C16H26O2Si |
| Molecular Weight | 278.47 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | (3-methylcyclohex-2-en-1-yl) 2-methyl-5-trimethylsilylpent-4-ynoate |
| SMILES | CC1=CC(OC(=O)C(C)CC#C[Si](C)(C)C)CCC1 |
| InChI | InChI=1S/C16H26O2Si/c1-13-8-6-10-15(12-13)18-16(17)14(2)9-7-11-19(3,4)5/h12,14-15H,6,8-10H2,1-5H3 |
| InChIKey | TYRWJGAFOMRCNP-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|