C29H48O3Si — CID 102494500
[(2R,3S,4E,6R,7S,8E)-3,5,7-trimethyl-2-triethylsilyloxydodeca-4,8-dien-10-yn-6-yl] oct-6-ynoate (PubChem CID 102494500) has the molecular formula C29H48O3Si and a molecular weight of 472.79 g/mol. Its IUPAC name is [(2R,3S,4E,6R,7S,8E)-3,5,7-trimethyl-2-triethylsilyloxydodeca-4,8-dien-10-yn-6-yl] oct-6-ynoate.
| Compound Name | [(2R,3S,4E,6R,7S,8E)-3,5,7-trimethyl-2-triethylsilyloxydodeca-4,8-dien-10-yn-6-yl] oct-6-ynoate |
|---|---|
| PubChem CID | 102494500 |
| Molecular Formula | C29H48O3Si |
| Molecular Weight | 472.79 g/mol |
| Exact Mass | 472.34 |
| IUPAC Name | [(2R,3S,4E,6R,7S,8E)-3,5,7-trimethyl-2-triethylsilyloxydodeca-4,8-dien-10-yn-6-yl] oct-6-ynoate |
| SMILES | CC#C/C=C/[C@H](C)[C@@H](OC(=O)CCCCC#CC)/C(C)=C/[C@H](C)[C@@H](C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C29H48O3Si/c1-10-15-17-18-20-22-28(30)31-29(24(6)21-19-16-11-2)26(8)23-25(7)27(9)32-33(12-3,13-4)14-5/h19,21,23-25,27,29H,12-14,17-18,20,22H2,1-9H3/b21-19+,26-23+/t24-,25-,27+,29+/m0/s1 |
| InChIKey | LLGDFQZECJMXIU-OWTSUCLGSA-N |
| XLogP | 7.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.79 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|