C17H22O5 — CID 135028463
dimethyl (1R,3aS,7aS)-5-methoxy-1,7a-dimethyl-3-methylidene-2,3a-dihydroindene-1,4-dicarboxylate (PubChem CID 135028463) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is dimethyl (1R,3aS,7aS)-5-methoxy-1,7a-dimethyl-3-methylidene-2,3a-dihydroindene-1,4-dicarboxylate.
| Compound Name | dimethyl (1R,3aS,7aS)-5-methoxy-1,7a-dimethyl-3-methylidene-2,3a-dihydroindene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 135028463 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | dimethyl (1R,3aS,7aS)-5-methoxy-1,7a-dimethyl-3-methylidene-2,3a-dihydroindene-1,4-dicarboxylate |
| SMILES | C=C1C[C@@](C)(C(=O)OC)[C@@]2(C)C=CC(OC)=C(C(=O)OC)[C@@H]12 |
| InChI | InChI=1S/C17H22O5/c1-10-9-17(3,15(19)22-6)16(2)8-7-11(20-4)12(13(10)16)14(18)21-5/h7-8,13H,1,9H2,2-6H3/t13-,16+,17+/m1/s1 |
| InChIKey | KCXBNQGKGLHUJQ-COXVUDFISA-N |
| XLogP | 2.39 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|