C15H18O3 — CID 15276259
(4R,4aS,7R,7aR)-4,4a,7,7a-tetramethyl-6,7-dihydro-4H-cyclopenta[f][1]benzofuran-2,5-dione (PubChem CID 15276259) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is (4R,4aS,7R,7aR)-4,4a,7,7a-tetramethyl-6,7-dihydro-4H-cyclopenta[f][1]benzofuran-2,5-dione.
| Compound Name | (4R,4aS,7R,7aR)-4,4a,7,7a-tetramethyl-6,7-dihydro-4H-cyclopenta[f][1]benzofuran-2,5-dione |
|---|---|
| PubChem CID | 15276259 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | (4R,4aS,7R,7aR)-4,4a,7,7a-tetramethyl-6,7-dihydro-4H-cyclopenta[f][1]benzofuran-2,5-dione |
| SMILES | C[C@@H]1CC(=O)[C@@]2(C)[C@H](C)C3=CC(=O)OC3=C[C@@]12C |
| InChI | InChI=1S/C15H18O3/c1-8-5-12(16)15(4)9(2)10-6-13(17)18-11(10)7-14(8,15)3/h6-9H,5H2,1-4H3/t8-,9-,14+,15-/m1/s1 |
| InChIKey | HKNJJLPZSUGXIH-NRYLCXMISA-N |
| XLogP | 2.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |