About dimethyl (1S,4R)-4-hydroxycyclopent-2-ene-1,2-dicarboxylate
dimethyl (1S,4R)-4-hydroxycyclopent-2-ene-1,2-dicarboxylate (PubChem CID 135028564) has the molecular formula C9H12O5
and a molecular weight of 200.19 g/mol. Its IUPAC name is dimethyl (1S,4R)-4-hydroxycyclopent-2-ene-1,2-dicarboxylate.
Analyze dimethyl (1S,4R)-4-hydroxycyclopent-2-ene-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (1S,4R)-4-hydroxycyclopent-2-ene-1,2-dicarboxylate?
The IUPAC name of dimethyl (1S,4R)-4-hydroxycyclopent-2-ene-1,2-dicarboxylate (CID 135028564) is dimethyl (1S,4R)-4-hydroxycyclopent-2-ene-1,2-dicarboxylate.
What is the SMILES notation for dimethyl (1S,4R)-4-hydroxycyclopent-2-ene-1,2-dicarboxylate?
The canonical SMILES for dimethyl (1S,4R)-4-hydroxycyclopent-2-ene-1,2-dicarboxylate is COC(=O)C1=C[C@H](O)C[C@@H]1C(=O)OC.
What is the InChIKey of dimethyl (1S,4R)-4-hydroxycyclopent-2-ene-1,2-dicarboxylate?
The InChIKey is ZARKYUCGESJJAO-FSPLSTOPSA-N. The full InChI is InChI=1S/C9H12O5/c1-13-8(11)6-3-5(10)4-7(6)9(12)14-2/h3,5,7,10H,4H2,1-2H3/t5-,7-/m0/s1.
What are the key properties of dimethyl (1S,4R)-4-hydroxycyclopent-2-ene-1,2-dicarboxylate?
dimethyl (1S,4R)-4-hydroxycyclopent-2-ene-1,2-dicarboxylate has a molecular weight of 200.19 g/mol, XLogP of -0.36, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (1S,4R)-4-hydroxycyclopent-2-ene-1,2-dicarboxylate is sourced from PubChem (CID 135028564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).