C19H32N2O5 — CID 135028914
ditert-butyl 4-formyl-2,8-diazaspiro[4.5]decane-2,8-dicarboxylate (PubChem CID 135028914) has the molecular formula C19H32N2O5 and a molecular weight of 368.47 g/mol. Its IUPAC name is ditert-butyl 4-formyl-2,8-diazaspiro[4.5]decane-2,8-dicarboxylate.
| Compound Name | ditert-butyl 4-formyl-2,8-diazaspiro[4.5]decane-2,8-dicarboxylate |
|---|---|
| PubChem CID | 135028914 |
| Molecular Formula | C19H32N2O5 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | ditert-butyl 4-formyl-2,8-diazaspiro[4.5]decane-2,8-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CN(C(=O)OC(C)(C)C)CC2C=O |
| InChI | InChI=1S/C19H32N2O5/c1-17(2,3)25-15(23)20-9-7-19(8-10-20)13-21(11-14(19)12-22)16(24)26-18(4,5)6/h12,14H,7-11,13H2,1-6H3 |
| InChIKey | NVVIFNLOXQVINN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|