C22H28O5 — CID 135029172
ditert-butyl 11-methylidene-3-oxospiro[5.5]undeca-1,4,9-triene-8,8-dicarboxylate (PubChem CID 135029172) has the molecular formula C22H28O5 and a molecular weight of 372.46 g/mol. Its IUPAC name is ditert-butyl 11-methylidene-3-oxospiro[5.5]undeca-1,4,9-triene-8,8-dicarboxylate.
| Compound Name | ditert-butyl 11-methylidene-3-oxospiro[5.5]undeca-1,4,9-triene-8,8-dicarboxylate |
|---|---|
| PubChem CID | 135029172 |
| Molecular Formula | C22H28O5 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | ditert-butyl 11-methylidene-3-oxospiro[5.5]undeca-1,4,9-triene-8,8-dicarboxylate |
| SMILES | C=C1C=CC(C(=O)OC(C)(C)C)(C(=O)OC(C)(C)C)CC12C=CC(=O)C=C2 |
| InChI | InChI=1S/C22H28O5/c1-15-8-13-22(17(24)26-19(2,3)4,18(25)27-20(5,6)7)14-21(15)11-9-16(23)10-12-21/h8-13H,1,14H2,2-7H3 |
| InChIKey | ZVZVWVPXYVRYNW-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|