C16H16O5 — CID 135029238
dimethyl 10-deuterio-11-methylidene-3-oxospiro[5.5]undeca-1,4,9-triene-8,8-dicarboxylate (PubChem CID 135029238) has the molecular formula C16H16O5 and a molecular weight of 289.31 g/mol. Its IUPAC name is dimethyl 10-deuterio-11-methylidene-3-oxospiro[5.5]undeca-1,4,9-triene-8,8-dicarboxylate.
| Compound Name | dimethyl 10-deuterio-11-methylidene-3-oxospiro[5.5]undeca-1,4,9-triene-8,8-dicarboxylate |
|---|---|
| PubChem CID | 135029238 |
| Molecular Formula | C16H16O5 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | dimethyl 10-deuterio-11-methylidene-3-oxospiro[5.5]undeca-1,4,9-triene-8,8-dicarboxylate |
| SMILES | [2H]C1=CC(C(=O)OC)(C(=O)OC)CC2(C=CC(=O)C=C2)C1=C |
| InChI | InChI=1S/C16H16O5/c1-11-4-9-16(13(18)20-2,14(19)21-3)10-15(11)7-5-12(17)6-8-15/h4-9H,1,10H2,2-3H3/i4D |
| InChIKey | LQMGEHHAZWQJDE-QYKNYGDISA-N |
| XLogP | 1.52 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|