C20H28O5 — CID 134837401
dimethyl 2-(2-methylprop-2-enyl)-2-[(E)-6-oxoundec-4-en-2-ynyl]propanedioate (PubChem CID 134837401) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is dimethyl 2-(2-methylprop-2-enyl)-2-[(E)-6-oxoundec-4-en-2-ynyl]propanedioate.
| Compound Name | dimethyl 2-(2-methylprop-2-enyl)-2-[(E)-6-oxoundec-4-en-2-ynyl]propanedioate |
|---|---|
| PubChem CID | 134837401 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | dimethyl 2-(2-methylprop-2-enyl)-2-[(E)-6-oxoundec-4-en-2-ynyl]propanedioate |
| SMILES | C=C(C)CC(CC#C/C=C/C(=O)CCCCC)(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C20H28O5/c1-6-7-9-12-17(21)13-10-8-11-14-20(15-16(2)3,18(22)24-4)19(23)25-5/h10,13H,2,6-7,9,12,14-15H2,1,3-5H3/b13-10+ |
| InChIKey | WFEKUUYGCCBWCW-JLHYYAGUSA-N |
| XLogP | 3.38 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|