C10H12O4 — CID 14482966
methyl 1,3-dimethyl-2,5-dioxocyclohex-3-ene-1-carboxylate (PubChem CID 14482966) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is methyl 1,3-dimethyl-2,5-dioxocyclohex-3-ene-1-carboxylate.
| Compound Name | methyl 1,3-dimethyl-2,5-dioxocyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 14482966 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | methyl 1,3-dimethyl-2,5-dioxocyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)C1(C)CC(=O)C=C(C)C1=O |
| InChI | InChI=1S/C10H12O4/c1-6-4-7(11)5-10(2,8(6)12)9(13)14-3/h4H,5H2,1-3H3 |
| InChIKey | VXKHWVICKAGVAF-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|