About methyl 1,3-dimethyl-2,5-dioxocyclohex-3-ene-1-carboxylate
methyl 1,3-dimethyl-2,5-dioxocyclohex-3-ene-1-carboxylate (PubChem CID 14482966) has the molecular formula C10H12O4
and a molecular weight of 196.20 g/mol. Its IUPAC name is methyl 1,3-dimethyl-2,5-dioxocyclohex-3-ene-1-carboxylate.
Molecular Properties
| Compound Name | methyl 1,3-dimethyl-2,5-dioxocyclohex-3-ene-1-carboxylate |
| PubChem CID | 14482966 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | methyl 1,3-dimethyl-2,5-dioxocyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)C1(C)CC(=O)C=C(C)C1=O |
| InChI | InChI=1S/C10H12O4/c1-6-4-7(11)5-10(2,8(6)12)9(13)14-3/h4H,5H2,1-3H3 |
| InChIKey | VXKHWVICKAGVAF-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 1,3-dimethyl-2,5-dioxocyclohex-3-ene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1,3-dimethyl-2,5-dioxocyclohex-3-ene-1-carboxylate?
The IUPAC name of methyl 1,3-dimethyl-2,5-dioxocyclohex-3-ene-1-carboxylate (CID 14482966) is methyl 1,3-dimethyl-2,5-dioxocyclohex-3-ene-1-carboxylate.
What is the SMILES notation for methyl 1,3-dimethyl-2,5-dioxocyclohex-3-ene-1-carboxylate?
The canonical SMILES for methyl 1,3-dimethyl-2,5-dioxocyclohex-3-ene-1-carboxylate is COC(=O)C1(C)CC(=O)C=C(C)C1=O.
What is the InChIKey of methyl 1,3-dimethyl-2,5-dioxocyclohex-3-ene-1-carboxylate?
The InChIKey is VXKHWVICKAGVAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O4/c1-6-4-7(11)5-10(2,8(6)12)9(13)14-3/h4H,5H2,1-3H3.
What are the key properties of methyl 1,3-dimethyl-2,5-dioxocyclohex-3-ene-1-carboxylate?
methyl 1,3-dimethyl-2,5-dioxocyclohex-3-ene-1-carboxylate has a molecular weight of 196.20 g/mol, XLogP of 0.65, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1,3-dimethyl-2,5-dioxocyclohex-3-ene-1-carboxylate is sourced from PubChem (CID 14482966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).