C11H14BF6KO4SSi — CID 135029525
potassium trifluoro-[3-methoxy-5-(trifluoromethylsulfonyloxy)-4-trimethylsilylphenyl]boranuide (PubChem CID 135029525) has the molecular formula C11H14BF6KO4SSi and a molecular weight of 434.28 g/mol. Its IUPAC name is potassium trifluoro-[3-methoxy-5-(trifluoromethylsulfonyloxy)-4-trimethylsilylphenyl]boranuide.
| Compound Name | potassium trifluoro-[3-methoxy-5-(trifluoromethylsulfonyloxy)-4-trimethylsilylphenyl]boranuide |
|---|---|
| PubChem CID | 135029525 |
| Molecular Formula | C11H14BF6KO4SSi |
| Molecular Weight | 434.28 g/mol |
| Exact Mass | 434.00 |
| IUPAC Name | potassium trifluoro-[3-methoxy-5-(trifluoromethylsulfonyloxy)-4-trimethylsilylphenyl]boranuide |
| SMILES | COc1cc([B-](F)(F)F)cc(OS(=O)(=O)C(F)(F)F)c1[Si](C)(C)C.[K+] |
| InChI | InChI=1S/C11H14BF6O4SSi.K/c1-21-8-5-7(12(16,17)18)6-9(10(8)24(2,3)4)22-23(19,20)11(13,14)15;/h5-6H,1-4H3;/q-1;+1 |
| InChIKey | RKHSCZDBHPDTND-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.28 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|