C17H27F3O7SSi — CID 46837542
[2-[tert-butyl(dimethyl)silyl]-3,5-bis(methoxymethoxy)phenyl] trifluoromethanesulfonate (PubChem CID 46837542) has the molecular formula C17H27F3O7SSi and a molecular weight of 460.54 g/mol. Its IUPAC name is [2-[tert-butyl(dimethyl)silyl]-3,5-bis(methoxymethoxy)phenyl] trifluoromethanesulfonate.
| Compound Name | [2-[tert-butyl(dimethyl)silyl]-3,5-bis(methoxymethoxy)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 46837542 |
| Molecular Formula | C17H27F3O7SSi |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | [2-[tert-butyl(dimethyl)silyl]-3,5-bis(methoxymethoxy)phenyl] trifluoromethanesulfonate |
| SMILES | COCOc1cc(OCOC)c([Si](C)(C)C(C)(C)C)c(OS(=O)(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C17H27F3O7SSi/c1-16(2,3)29(6,7)15-13(26-11-24-5)8-12(25-10-23-4)9-14(15)27-28(21,22)17(18,19)20/h8-9H,10-11H2,1-7H3 |
| InChIKey | SUQIMFJVUVTRAX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|