C34H23F6NO2 — CID 135029727
ethyl 4,5-bis(4-phenylphenyl)-3,6-bis(trifluoromethyl)pyridine-2-carboxylate (PubChem CID 135029727) has the molecular formula C34H23F6NO2 and a molecular weight of 591.55 g/mol. Its IUPAC name is ethyl 4,5-bis(4-phenylphenyl)-3,6-bis(trifluoromethyl)pyridine-2-carboxylate.
| Compound Name | ethyl 4,5-bis(4-phenylphenyl)-3,6-bis(trifluoromethyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 135029727 |
| Molecular Formula | C34H23F6NO2 |
| Molecular Weight | 591.55 g/mol |
| Exact Mass | 591.16 |
| IUPAC Name | ethyl 4,5-bis(4-phenylphenyl)-3,6-bis(trifluoromethyl)pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1nc(C(F)(F)F)c(-c2ccc(-c3ccccc3)cc2)c(-c2ccc(-c3ccccc3)cc2)c1C(F)(F)F |
| InChI | InChI=1S/C34H23F6NO2/c1-2-43-32(42)30-29(33(35,36)37)27(25-17-13-23(14-18-25)21-9-5-3-6-10-21)28(31(41-30)34(38,39)40)26-19-15-24(16-20-26)22-11-7-4-8-12-22/h3-20H,2H2,1H3 |
| InChIKey | ZSKBWKSHDNOINC-UHFFFAOYSA-N |
| XLogP | 9.96 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.55 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |