C16H16N2O — CID 135030036
(1R,10bR)-3'-methylspiro[2,5,6,10b-tetrahydropyrrolo[2,1-a]isoquinoline-1,2'-pyrrole]-3-one (PubChem CID 135030036) has the molecular formula C16H16N2O and a molecular weight of 252.32 g/mol. Its IUPAC name is (1R,10bR)-3'-methylspiro[2,5,6,10b-tetrahydropyrrolo[2,1-a]isoquinoline-1,2'-pyrrole]-3-one.
| Compound Name | (1R,10bR)-3'-methylspiro[2,5,6,10b-tetrahydropyrrolo[2,1-a]isoquinoline-1,2'-pyrrole]-3-one |
|---|---|
| PubChem CID | 135030036 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | (1R,10bR)-3'-methylspiro[2,5,6,10b-tetrahydropyrrolo[2,1-a]isoquinoline-1,2'-pyrrole]-3-one |
| SMILES | CC1=CC=N[C@]12CC(=O)N1CCc3ccccc3[C@@H]12 |
| InChI | InChI=1S/C16H16N2O/c1-11-6-8-17-16(11)10-14(19)18-9-7-12-4-2-3-5-13(12)15(16)18/h2-6,8,15H,7,9-10H2,1H3/t15-,16-/m1/s1 |
| InChIKey | YOTHQPBRFAVTGM-HZPDHXFCSA-N |
| XLogP | 2.29 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |