C22H20N2O — CID 135030037
(1R,10bR)-3'-methyl-5'-phenylspiro[2,5,6,10b-tetrahydropyrrolo[2,1-a]isoquinoline-1,2'-pyrrole]-3-one (PubChem CID 135030037) has the molecular formula C22H20N2O and a molecular weight of 328.41 g/mol. Its IUPAC name is (1R,10bR)-3'-methyl-5'-phenylspiro[2,5,6,10b-tetrahydropyrrolo[2,1-a]isoquinoline-1,2'-pyrrole]-3-one.
| Compound Name | (1R,10bR)-3'-methyl-5'-phenylspiro[2,5,6,10b-tetrahydropyrrolo[2,1-a]isoquinoline-1,2'-pyrrole]-3-one |
|---|---|
| PubChem CID | 135030037 |
| Molecular Formula | C22H20N2O |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | (1R,10bR)-3'-methyl-5'-phenylspiro[2,5,6,10b-tetrahydropyrrolo[2,1-a]isoquinoline-1,2'-pyrrole]-3-one |
| SMILES | CC1=CC(c2ccccc2)=N[C@]12CC(=O)N1CCc3ccccc3[C@@H]12 |
| InChI | InChI=1S/C22H20N2O/c1-15-13-19(17-8-3-2-4-9-17)23-22(15)14-20(25)24-12-11-16-7-5-6-10-18(16)21(22)24/h2-10,13,21H,11-12,14H2,1H3/t21-,22-/m1/s1 |
| InChIKey | CSRWDFQBFNOSPV-FGZHOGPDSA-N |
| XLogP | 3.70 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |