C18H15F3O2 — CID 135031107
3,3-diphenyl-5-(2,2,2-trifluoroethyl)oxolan-2-one (PubChem CID 135031107) has the molecular formula C18H15F3O2 and a molecular weight of 320.31 g/mol. Its IUPAC name is 3,3-diphenyl-5-(2,2,2-trifluoroethyl)oxolan-2-one.
| Compound Name | 3,3-diphenyl-5-(2,2,2-trifluoroethyl)oxolan-2-one |
|---|---|
| PubChem CID | 135031107 |
| Molecular Formula | C18H15F3O2 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 3,3-diphenyl-5-(2,2,2-trifluoroethyl)oxolan-2-one |
| SMILES | O=C1OC(CC(F)(F)F)CC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H15F3O2/c19-18(20,21)12-15-11-17(16(22)23-15,13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15H,11-12H2 |
| InChIKey | BUPLJSMDFGNXBR-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |