C16H15BrO4S — CID 135031130
ethyl (2R)-2-(benzenesulfonyl)-2-(4-bromophenyl)acetate (PubChem CID 135031130) has the molecular formula C16H15BrO4S and a molecular weight of 383.26 g/mol. Its IUPAC name is ethyl (2R)-2-(benzenesulfonyl)-2-(4-bromophenyl)acetate.
| Compound Name | ethyl (2R)-2-(benzenesulfonyl)-2-(4-bromophenyl)acetate |
|---|---|
| PubChem CID | 135031130 |
| Molecular Formula | C16H15BrO4S |
| Molecular Weight | 383.26 g/mol |
| Exact Mass | 381.99 |
| IUPAC Name | ethyl (2R)-2-(benzenesulfonyl)-2-(4-bromophenyl)acetate |
| SMILES | CCOC(=O)[C@@H](c1ccc(Br)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H15BrO4S/c1-2-21-16(18)15(12-8-10-13(17)11-9-12)22(19,20)14-6-4-3-5-7-14/h3-11,15H,2H2,1H3/t15-/m1/s1 |
| InChIKey | QSFWDSRAMKDHQF-OAHLLOKOSA-N |
| XLogP | 3.53 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.26 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |