C18H16BrFO4S — CID 139095419
methyl (2S,3R)-2-(benzenesulfonyl)-3-(4-bromophenyl)-2-fluoropent-4-enoate (PubChem CID 139095419) has the molecular formula C18H16BrFO4S and a molecular weight of 427.29 g/mol. Its IUPAC name is methyl (2S,3R)-2-(benzenesulfonyl)-3-(4-bromophenyl)-2-fluoropent-4-enoate.
| Compound Name | methyl (2S,3R)-2-(benzenesulfonyl)-3-(4-bromophenyl)-2-fluoropent-4-enoate |
|---|---|
| PubChem CID | 139095419 |
| Molecular Formula | C18H16BrFO4S |
| Molecular Weight | 427.29 g/mol |
| Exact Mass | 425.99 |
| IUPAC Name | methyl (2S,3R)-2-(benzenesulfonyl)-3-(4-bromophenyl)-2-fluoropent-4-enoate |
| SMILES | C=C[C@H](c1ccc(Br)cc1)[C@@](F)(C(=O)OC)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H16BrFO4S/c1-3-16(13-9-11-14(19)12-10-13)18(20,17(21)24-2)25(22,23)15-7-5-4-6-8-15/h3-12,16H,1H2,2H3/t16-,18+/m1/s1 |
| InChIKey | ODBSXNKRBHDBTL-AEFFLSMTSA-N |
| XLogP | 4.03 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.29 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|