C19H20BrFO4S — CID 123256383
5-[4-(4-bromo-2-fluorophenyl)phenyl]sulfonylpentyl acetate (PubChem CID 123256383) has the molecular formula C19H20BrFO4S and a molecular weight of 443.33 g/mol. Its IUPAC name is 5-[4-(4-bromo-2-fluorophenyl)phenyl]sulfonylpentyl acetate.
| Compound Name | 5-[4-(4-bromo-2-fluorophenyl)phenyl]sulfonylpentyl acetate |
|---|---|
| PubChem CID | 123256383 |
| Molecular Formula | C19H20BrFO4S |
| Molecular Weight | 443.33 g/mol |
| Exact Mass | 442.02 |
| IUPAC Name | 5-[4-(4-bromo-2-fluorophenyl)phenyl]sulfonylpentyl acetate |
| SMILES | CC(=O)OCCCCCS(=O)(=O)c1ccc(-c2ccc(Br)cc2F)cc1 |
| InChI | InChI=1S/C19H20BrFO4S/c1-14(22)25-11-3-2-4-12-26(23,24)17-8-5-15(6-9-17)18-10-7-16(20)13-19(18)21/h5-10,13H,2-4,11-12H2,1H3 |
| InChIKey | LVQLYNXCNYHWIX-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.33 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|