C20H19BrO4S — CID 139193597
ethyl (2E,4E)-5-(4-bromophenyl)-2-(4-methylphenyl)sulfonylpenta-2,4-dienoate (PubChem CID 139193597) has the molecular formula C20H19BrO4S and a molecular weight of 435.34 g/mol. Its IUPAC name is ethyl (2E,4E)-5-(4-bromophenyl)-2-(4-methylphenyl)sulfonylpenta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-5-(4-bromophenyl)-2-(4-methylphenyl)sulfonylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 139193597 |
| Molecular Formula | C20H19BrO4S |
| Molecular Weight | 435.34 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | ethyl (2E,4E)-5-(4-bromophenyl)-2-(4-methylphenyl)sulfonylpenta-2,4-dienoate |
| SMILES | CCOC(=O)/C(=C\C=C\c1ccc(Br)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H19BrO4S/c1-3-25-20(22)19(6-4-5-16-9-11-17(21)12-10-16)26(23,24)18-13-7-15(2)8-14-18/h4-14H,3H2,1-2H3/b5-4+,19-6+ |
| InChIKey | SHQBIDLNERBFQT-QZRSKMOPSA-N |
| XLogP | 4.69 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.34 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|