About (1S)-2-[3-(pentafluoro-λ6-sulfanyl)phenyl]-1-phenylethanol
(1S)-2-[3-(pentafluoro-λ6-sulfanyl)phenyl]-1-phenylethanol (PubChem CID 135031374) has the molecular formula C14H13F5OS
and a molecular weight of 324.31 g/mol. Its IUPAC name is (1S)-2-[3-(pentafluoro-λ6-sulfanyl)phenyl]-1-phenylethanol.
Molecular Properties
| Compound Name | (1S)-2-[3-(pentafluoro-λ6-sulfanyl)phenyl]-1-phenylethanol |
| PubChem CID | 135031374 |
| Molecular Formula | C14H13F5OS |
| Molecular Weight | 324.31 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | (1S)-2-[3-(pentafluoro-λ6-sulfanyl)phenyl]-1-phenylethanol |
| SMILES | O[C@@H](Cc1cccc(S(F)(F)(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C14H13F5OS/c15-21(16,17,18,19)13-8-4-5-11(9-13)10-14(20)12-6-2-1-3-7-12/h1-9,14,20H,10H2/t14-/m0/s1 |
| InChIKey | JARVHIYOPNDTSB-AWEZNQCLSA-N |
| XLogP | 5.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 324.31 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (1S)-2-[3-(pentafluoro-λ6-sulfanyl)phenyl]-1-phenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-2-[3-(pentafluoro-λ6-sulfanyl)phenyl]-1-phenylethanol?
The IUPAC name of (1S)-2-[3-(pentafluoro-λ6-sulfanyl)phenyl]-1-phenylethanol (CID 135031374) is (1S)-2-[3-(pentafluoro-λ6-sulfanyl)phenyl]-1-phenylethanol.
What is the SMILES notation for (1S)-2-[3-(pentafluoro-λ6-sulfanyl)phenyl]-1-phenylethanol?
The canonical SMILES for (1S)-2-[3-(pentafluoro-λ6-sulfanyl)phenyl]-1-phenylethanol is O[C@@H](Cc1cccc(S(F)(F)(F)(F)F)c1)c1ccccc1.
What is the InChIKey of (1S)-2-[3-(pentafluoro-λ6-sulfanyl)phenyl]-1-phenylethanol?
The InChIKey is JARVHIYOPNDTSB-AWEZNQCLSA-N. The full InChI is InChI=1S/C14H13F5OS/c15-21(16,17,18,19)13-8-4-5-11(9-13)10-14(20)12-6-2-1-3-7-12/h1-9,14,20H,10H2/t14-/m0/s1.
What are the key properties of (1S)-2-[3-(pentafluoro-λ6-sulfanyl)phenyl]-1-phenylethanol?
(1S)-2-[3-(pentafluoro-λ6-sulfanyl)phenyl]-1-phenylethanol has a molecular weight of 324.31 g/mol, XLogP of 5.62, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-2-[3-(pentafluoro-λ6-sulfanyl)phenyl]-1-phenylethanol is sourced from PubChem (CID 135031374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).