C26H32N2O3 — CID 135031457
(3aS,7R,7aR)-3,5-dibenzyl-3a-cyclobutyl-7-(methoxymethyl)-4,6,7,7a-tetrahydro-[1,3]oxazolo[4,5-c]pyridin-2-one (PubChem CID 135031457) has the molecular formula C26H32N2O3 and a molecular weight of 420.55 g/mol. Its IUPAC name is (3aS,7R,7aR)-3,5-dibenzyl-3a-cyclobutyl-7-(methoxymethyl)-4,6,7,7a-tetrahydro-[1,3]oxazolo[4,5-c]pyridin-2-one.
| Compound Name | (3aS,7R,7aR)-3,5-dibenzyl-3a-cyclobutyl-7-(methoxymethyl)-4,6,7,7a-tetrahydro-[1,3]oxazolo[4,5-c]pyridin-2-one |
|---|---|
| PubChem CID | 135031457 |
| Molecular Formula | C26H32N2O3 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | (3aS,7R,7aR)-3,5-dibenzyl-3a-cyclobutyl-7-(methoxymethyl)-4,6,7,7a-tetrahydro-[1,3]oxazolo[4,5-c]pyridin-2-one |
| SMILES | COC[C@H]1CN(Cc2ccccc2)C[C@@]2(C3CCC3)[C@@H]1OC(=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C26H32N2O3/c1-30-18-22-17-27(15-20-9-4-2-5-10-20)19-26(23-13-8-14-23)24(22)31-25(29)28(26)16-21-11-6-3-7-12-21/h2-7,9-12,22-24H,8,13-19H2,1H3/t22-,24-,26-/m1/s1 |
| InChIKey | HTCYXYDGNBSWMW-QIGHUWCUSA-N |
| XLogP | 4.32 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |