C22H23F3N2O2 — CID 146046734
8a-benzyl-7-[[3-(2,2,2-trifluoroethyl)phenyl]methyl]-1,5,6,8-tetrahydro-[1,3]oxazolo[3,4-a]pyrazin-3-one (PubChem CID 146046734) has the molecular formula C22H23F3N2O2 and a molecular weight of 404.43 g/mol. Its IUPAC name is 8a-benzyl-7-[[3-(2,2,2-trifluoroethyl)phenyl]methyl]-1,5,6,8-tetrahydro-[1,3]oxazolo[3,4-a]pyrazin-3-one.
| Compound Name | 8a-benzyl-7-[[3-(2,2,2-trifluoroethyl)phenyl]methyl]-1,5,6,8-tetrahydro-[1,3]oxazolo[3,4-a]pyrazin-3-one |
|---|---|
| PubChem CID | 146046734 |
| Molecular Formula | C22H23F3N2O2 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 8a-benzyl-7-[[3-(2,2,2-trifluoroethyl)phenyl]methyl]-1,5,6,8-tetrahydro-[1,3]oxazolo[3,4-a]pyrazin-3-one |
| SMILES | O=C1OCC2(Cc3ccccc3)CN(Cc3cccc(CC(F)(F)F)c3)CCN12 |
| InChI | InChI=1S/C22H23F3N2O2/c23-22(24,25)13-18-7-4-8-19(11-18)14-26-9-10-27-20(28)29-16-21(27,15-26)12-17-5-2-1-3-6-17/h1-8,11H,9-10,12-16H2 |
| InChIKey | ZKJDBKROBCTJGW-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |