C39H39N3O3 — CID 135032037
4-phenyl-2-[[2,4,6-trimethyl-3,5-bis[[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]methyl]phenyl]methyl]-4,5-dihydro-1,3-oxazole (PubChem CID 135032037) has the molecular formula C39H39N3O3 and a molecular weight of 597.76 g/mol. Its IUPAC name is 4-phenyl-2-[[2,4,6-trimethyl-3,5-bis[[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]methyl]phenyl]methyl]-4,5-dihydro-1,3-oxazole.
| Compound Name | 4-phenyl-2-[[2,4,6-trimethyl-3,5-bis[[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]methyl]phenyl]methyl]-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 135032037 |
| Molecular Formula | C39H39N3O3 |
| Molecular Weight | 597.76 g/mol |
| Exact Mass | 597.30 |
| IUPAC Name | 4-phenyl-2-[[2,4,6-trimethyl-3,5-bis[[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]methyl]phenyl]methyl]-4,5-dihydro-1,3-oxazole |
| SMILES | Cc1c(CC2=NC(c3ccccc3)CO2)c(C)c(CC2=N[C@@H](c3ccccc3)CO2)c(C)c1CC1=N[C@@H](c2ccccc2)CO1 |
| InChI | InChI=1S/C39H39N3O3/c1-25-31(19-37-40-34(22-43-37)28-13-7-4-8-14-28)26(2)33(21-39-42-36(24-45-39)30-17-11-6-12-18-30)27(3)32(25)20-38-41-35(23-44-38)29-15-9-5-10-16-29/h4-18,34-36H,19-24H2,1-3H3/t34-,35-,36?/m1/s1 |
| InChIKey | ZJXMXDZUQDMNDY-CLDIWPSMSA-N |
| XLogP | 7.75 |
| TPSA | 64.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.76 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |