C21H26OS — CID 135032118
(1S,2R)-1-cyclohexyl-3-phenyl-2-phenylsulfanylpropan-1-ol (PubChem CID 135032118) has the molecular formula C21H26OS and a molecular weight of 326.50 g/mol. Its IUPAC name is (1S,2R)-1-cyclohexyl-3-phenyl-2-phenylsulfanylpropan-1-ol.
| Compound Name | (1S,2R)-1-cyclohexyl-3-phenyl-2-phenylsulfanylpropan-1-ol |
|---|---|
| PubChem CID | 135032118 |
| Molecular Formula | C21H26OS |
| Molecular Weight | 326.50 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | (1S,2R)-1-cyclohexyl-3-phenyl-2-phenylsulfanylpropan-1-ol |
| SMILES | O[C@@H](C1CCCCC1)[C@@H](Cc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C21H26OS/c22-21(18-12-6-2-7-13-18)20(16-17-10-4-1-5-11-17)23-19-14-8-3-9-15-19/h1,3-5,8-11,14-15,18,20-22H,2,6-7,12-13,16H2/t20-,21+/m1/s1 |
| InChIKey | YBMSWQSYVWHIIT-RTWAWAEBSA-N |
| XLogP | 5.33 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.50 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |