C19H21F6N5 — CID 135032227
(2R,3S,5R)-2-(2,5-difluorophenyl)-5-(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)-1-[(2S)-2,3,3,3-tetrafluoropropyl]piperidin-3-amine (PubChem CID 135032227) has the molecular formula C19H21F6N5 and a molecular weight of 433.40 g/mol. Its IUPAC name is (2R,3S,5R)-2-(2,5-difluorophenyl)-5-(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)-1-[(2S)-2,3,3,3-tetrafluoropropyl]piperidin-3-amine.
| Compound Name | (2R,3S,5R)-2-(2,5-difluorophenyl)-5-(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)-1-[(2S)-2,3,3,3-tetrafluoropropyl]piperidin-3-amine |
|---|---|
| PubChem CID | 135032227 |
| Molecular Formula | C19H21F6N5 |
| Molecular Weight | 433.40 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | (2R,3S,5R)-2-(2,5-difluorophenyl)-5-(4,6-dihydro-1H-pyrrolo[3,4-d]pyrazol-5-yl)-1-[(2S)-2,3,3,3-tetrafluoropropyl]piperidin-3-amine |
| SMILES | N[C@H]1C[C@@H](N2Cc3cn[nH]c3C2)CN(C[C@H](F)C(F)(F)F)[C@@H]1c1cc(F)ccc1F |
| InChI | InChI=1S/C19H21F6N5/c20-11-1-2-14(21)13(3-11)18-15(26)4-12(7-30(18)9-17(22)19(23,24)25)29-6-10-5-27-28-16(10)8-29/h1-3,5,12,15,17-18H,4,6-9,26H2,(H,27,28)/t12-,15+,17+,18-/m1/s1 |
| InChIKey | ZMHYJTVZAJAUIX-BGIURUKPSA-N |
| XLogP | 3.05 |
| TPSA | 61.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |