C18H22F3N5O2S — CID 91808783
(3S,5R)-1-methyl-5-(2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)-2-(2,4,5-trifluorophenyl)piperidin-3-amine (PubChem CID 91808783) has the molecular formula C18H22F3N5O2S and a molecular weight of 429.47 g/mol. Its IUPAC name is (3S,5R)-1-methyl-5-(2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)-2-(2,4,5-trifluorophenyl)piperidin-3-amine.
| Compound Name | (3S,5R)-1-methyl-5-(2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)-2-(2,4,5-trifluorophenyl)piperidin-3-amine |
|---|---|
| PubChem CID | 91808783 |
| Molecular Formula | C18H22F3N5O2S |
| Molecular Weight | 429.47 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | (3S,5R)-1-methyl-5-(2-methylsulfonyl-4,6-dihydropyrrolo[3,4-c]pyrazol-5-yl)-2-(2,4,5-trifluorophenyl)piperidin-3-amine |
| SMILES | CN1C[C@H](N2Cc3cn(S(C)(=O)=O)nc3C2)C[C@H](N)C1c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C18H22F3N5O2S/c1-24-8-11(25-6-10-7-26(29(2,27)28)23-17(10)9-25)3-16(22)18(24)12-4-14(20)15(21)5-13(12)19/h4-5,7,11,16,18H,3,6,8-9,22H2,1-2H3/t11-,16+,18?/m1/s1 |
| InChIKey | PXWNVWRPDHAUBO-HJHRRKNKSA-N |
| XLogP | 1.20 |
| TPSA | 84.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.47 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|