C18H29NO4 — CID 135032295
tert-butyl (2S)-2-(cycloheptene-1-carbonyloxymethyl)pyrrolidine-1-carboxylate (PubChem CID 135032295) has the molecular formula C18H29NO4 and a molecular weight of 323.43 g/mol. Its IUPAC name is tert-butyl (2S)-2-(cycloheptene-1-carbonyloxymethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-(cycloheptene-1-carbonyloxymethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 135032295 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | tert-butyl (2S)-2-(cycloheptene-1-carbonyloxymethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1COC(=O)C1=CCCCCC1 |
| InChI | InChI=1S/C18H29NO4/c1-18(2,3)23-17(21)19-12-8-11-15(19)13-22-16(20)14-9-6-4-5-7-10-14/h9,15H,4-8,10-13H2,1-3H3/t15-/m0/s1 |
| InChIKey | LHIVUCKVTWFEPD-HNNXBMFYSA-N |
| XLogP | 3.82 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |