C9H20N2 — CID 135032582
1,1-dimethyl-2-(5-methylhex-5-enyl)hydrazine (PubChem CID 135032582) has the molecular formula C9H20N2 and a molecular weight of 156.27 g/mol. Its IUPAC name is 1,1-dimethyl-2-(5-methylhex-5-enyl)hydrazine.
| Compound Name | 1,1-dimethyl-2-(5-methylhex-5-enyl)hydrazine |
|---|---|
| PubChem CID | 135032582 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | 1,1-dimethyl-2-(5-methylhex-5-enyl)hydrazine |
| SMILES | C=C(C)CCCCNN(C)C |
| InChI | InChI=1S/C9H20N2/c1-9(2)7-5-6-8-10-11(3)4/h10H,1,5-8H2,2-4H3 |
| InChIKey | PIYFRGWFHQCGEY-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|