C25H29NO2 — CID 135032780
(3R,4R,5R)-4-[benzyl-[(1S)-1-phenylethyl]amino]-3,5-bis(prop-2-enyl)oxolan-2-one (PubChem CID 135032780) has the molecular formula C25H29NO2 and a molecular weight of 375.51 g/mol. Its IUPAC name is (3R,4R,5R)-4-[benzyl-[(1S)-1-phenylethyl]amino]-3,5-bis(prop-2-enyl)oxolan-2-one.
| Compound Name | (3R,4R,5R)-4-[benzyl-[(1S)-1-phenylethyl]amino]-3,5-bis(prop-2-enyl)oxolan-2-one |
|---|---|
| PubChem CID | 135032780 |
| Molecular Formula | C25H29NO2 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | (3R,4R,5R)-4-[benzyl-[(1S)-1-phenylethyl]amino]-3,5-bis(prop-2-enyl)oxolan-2-one |
| SMILES | C=CC[C@H]1OC(=O)[C@H](CC=C)[C@H]1N(Cc1ccccc1)[C@@H](C)c1ccccc1 |
| InChI | InChI=1S/C25H29NO2/c1-4-12-22-24(23(13-5-2)28-25(22)27)26(18-20-14-8-6-9-15-20)19(3)21-16-10-7-11-17-21/h4-11,14-17,19,22-24H,1-2,12-13,18H2,3H3/t19-,22+,23+,24+/m0/s1 |
| InChIKey | UGVVYEUCYFMWQU-GDKQOWJMSA-N |
| XLogP | 5.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|