C3Cl2N3O4- — CID 135033138
1,3-dichloro-5-oxido-1,3,5-triazinane-2,4,6-trione (PubChem CID 135033138) has the molecular formula C3Cl2N3O4- and a molecular weight of 212.96 g/mol. Its IUPAC name is 1,3-dichloro-5-oxido-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3-dichloro-5-oxido-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 135033138 |
| Molecular Formula | C3Cl2N3O4- |
| Molecular Weight | 212.96 g/mol |
| Exact Mass | 211.93 |
| IUPAC Name | 1,3-dichloro-5-oxido-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=c1n([O-])c(=O)n(Cl)c(=O)n1Cl |
| InChI | InChI=1S/C3Cl2N3O4/c4-6-1(9)7(5)3(11)8(12)2(6)10/q-1 |
| InChIKey | FTMDJSUIKUZVEH-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 89.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.96 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|