C22H32FNO2 — CID 135033897
2-[2-ethoxy-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)pent-1-en-3-yl]oxy-6-fluoropyridine (PubChem CID 135033897) has the molecular formula C22H32FNO2 and a molecular weight of 361.50 g/mol. Its IUPAC name is 2-[2-ethoxy-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)pent-1-en-3-yl]oxy-6-fluoropyridine.
| Compound Name | 2-[2-ethoxy-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)pent-1-en-3-yl]oxy-6-fluoropyridine |
|---|---|
| PubChem CID | 135033897 |
| Molecular Formula | C22H32FNO2 |
| Molecular Weight | 361.50 g/mol |
| Exact Mass | 361.24 |
| IUPAC Name | 2-[2-ethoxy-3-methyl-5-(2,6,6-trimethylcyclohexen-1-yl)pent-1-en-3-yl]oxy-6-fluoropyridine |
| SMILES | C=C(OCC)C(C)(CCC1=C(C)CCCC1(C)C)Oc1cccc(F)n1 |
| InChI | InChI=1S/C22H32FNO2/c1-7-25-17(3)22(6,26-20-12-8-11-19(23)24-20)15-13-18-16(2)10-9-14-21(18,4)5/h8,11-12H,3,7,9-10,13-15H2,1-2,4-6H3 |
| InChIKey | KRUNJMDLQQKTAH-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.50 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|