C13H10F3NO — CID 135043638
2-phenyl-6-(2,2,2-trifluoroethoxy)pyridine (PubChem CID 135043638) has the molecular formula C13H10F3NO and a molecular weight of 253.22 g/mol. Its IUPAC name is 2-phenyl-6-(2,2,2-trifluoroethoxy)pyridine.
| Compound Name | 2-phenyl-6-(2,2,2-trifluoroethoxy)pyridine |
|---|---|
| PubChem CID | 135043638 |
| Molecular Formula | C13H10F3NO |
| Molecular Weight | 253.22 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 2-phenyl-6-(2,2,2-trifluoroethoxy)pyridine |
| SMILES | FC(F)(F)COc1cccc(-c2ccccc2)n1 |
| InChI | InChI=1S/C13H10F3NO/c14-13(15,16)9-18-12-8-4-7-11(17-12)10-5-2-1-3-6-10/h1-8H,9H2 |
| InChIKey | WYSXRZLYSAHQBE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.22 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |