C17H26O3 — CID 135035104
ethyl (5aS,9aR,9bS)-6,6-dimethyl-1,4,5,5a,7,8,9,9b-octahydrobenzo[e][2]benzofuran-9a-carboxylate (PubChem CID 135035104) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is ethyl (5aS,9aR,9bS)-6,6-dimethyl-1,4,5,5a,7,8,9,9b-octahydrobenzo[e][2]benzofuran-9a-carboxylate.
| Compound Name | ethyl (5aS,9aR,9bS)-6,6-dimethyl-1,4,5,5a,7,8,9,9b-octahydrobenzo[e][2]benzofuran-9a-carboxylate |
|---|---|
| PubChem CID | 135035104 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | ethyl (5aS,9aR,9bS)-6,6-dimethyl-1,4,5,5a,7,8,9,9b-octahydrobenzo[e][2]benzofuran-9a-carboxylate |
| SMILES | CCOC(=O)[C@]12CCCC(C)(C)[C@@H]1CCC1=COC[C@@H]12 |
| InChI | InChI=1S/C17H26O3/c1-4-20-15(18)17-9-5-8-16(2,3)14(17)7-6-12-10-19-11-13(12)17/h10,13-14H,4-9,11H2,1-3H3/t13-,14-,17-/m0/s1 |
| InChIKey | PMUAJMLKOWLKMV-ZQIUZPCESA-N |
| XLogP | 3.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |