C20H24N2O3 — CID 135035311
methyl (1R,9S,10R,12R,13E)-13-ethylidene-10-hydroxy-8,15-diazapentacyclo[10.5.1.01,9.02,7.010,15]octadeca-2,4,6-triene-18-carboxylate (PubChem CID 135035311) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is methyl (1R,9S,10R,12R,13E)-13-ethylidene-10-hydroxy-8,15-diazapentacyclo[10.5.1.01,9.02,7.010,15]octadeca-2,4,6-triene-18-carboxylate.
| Compound Name | methyl (1R,9S,10R,12R,13E)-13-ethylidene-10-hydroxy-8,15-diazapentacyclo[10.5.1.01,9.02,7.010,15]octadeca-2,4,6-triene-18-carboxylate |
|---|---|
| PubChem CID | 135035311 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | methyl (1R,9S,10R,12R,13E)-13-ethylidene-10-hydroxy-8,15-diazapentacyclo[10.5.1.01,9.02,7.010,15]octadeca-2,4,6-triene-18-carboxylate |
| SMILES | C/C=C1/CN2CC[C@@]34c5ccccc5N[C@@H]3[C@]2(O)C[C@@H]1C4C(=O)OC |
| InChI | InChI=1S/C20H24N2O3/c1-3-12-11-22-9-8-19-14-6-4-5-7-15(14)21-18(19)20(22,24)10-13(12)16(19)17(23)25-2/h3-7,13,16,18,21,24H,8-11H2,1-2H3/b12-3-/t13-,16?,18-,19-,20+/m0/s1 |
| InChIKey | GQIPSWAKIHBPJT-DXNNBRHPSA-N |
| XLogP | 1.88 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|