C20H38O7Si2 — CID 135035531
(5S,8S)-8-[tert-butyl(dimethyl)silyl]oxy-3-methyl-9-(2-trimethylsilylethoxymethoxy)-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-one (PubChem CID 135035531) has the molecular formula C20H38O7Si2 and a molecular weight of 446.69 g/mol. Its IUPAC name is (5S,8S)-8-[tert-butyl(dimethyl)silyl]oxy-3-methyl-9-(2-trimethylsilylethoxymethoxy)-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-one.
| Compound Name | (5S,8S)-8-[tert-butyl(dimethyl)silyl]oxy-3-methyl-9-(2-trimethylsilylethoxymethoxy)-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-one |
|---|---|
| PubChem CID | 135035531 |
| Molecular Formula | C20H38O7Si2 |
| Molecular Weight | 446.69 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | (5S,8S)-8-[tert-butyl(dimethyl)silyl]oxy-3-methyl-9-(2-trimethylsilylethoxymethoxy)-2,4,10-trioxatricyclo[3.3.1.13,7]decan-6-one |
| SMILES | CC12OC3C(=O)[C@@H](O1)C(OCOCC[Si](C)(C)C)C(O2)[C@@H]3O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H38O7Si2/c1-19(2,3)29(8,9)27-18-15-13(21)14-16(17(18)26-20(4,24-14)25-15)23-12-22-10-11-28(5,6)7/h14-18H,10-12H2,1-9H3/t14-,15?,16?,17?,18-,20?/m1/s1 |
| InChIKey | RKYJRJXNWUPBKL-MVJVIOSPSA-N |
| XLogP | 3.51 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.69 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|