C22H16ClN3O — CID 135035698
14-chloro-8,12-dimethyl-17-phenyl-8,10,15-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2,4,6,11(16),12,14-heptaen-9-one (PubChem CID 135035698) has the molecular formula C22H16ClN3O and a molecular weight of 373.84 g/mol. Its IUPAC name is 14-chloro-8,12-dimethyl-17-phenyl-8,10,15-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2,4,6,11(16),12,14-heptaen-9-one.
| Compound Name | 14-chloro-8,12-dimethyl-17-phenyl-8,10,15-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2,4,6,11(16),12,14-heptaen-9-one |
|---|---|
| PubChem CID | 135035698 |
| Molecular Formula | C22H16ClN3O |
| Molecular Weight | 373.84 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 14-chloro-8,12-dimethyl-17-phenyl-8,10,15-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2,4,6,11(16),12,14-heptaen-9-one |
| SMILES | Cc1cc(Cl)nc2c(-c3ccccc3)c3c4ccccc4n(C)c(=O)n3c12 |
| InChI | InChI=1S/C22H16ClN3O/c1-13-12-17(23)24-19-18(14-8-4-3-5-9-14)21-15-10-6-7-11-16(15)25(2)22(27)26(21)20(13)19/h3-12H,1-2H3 |
| InChIKey | JTFDBEVBKBOHDM-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 39.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.84 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|