C19H32O2Si2 — CID 135036246
trimethyl-[[(1R,6R,9R)-10-methylidene-2-trimethylsilyloxy-8-tricyclo[7.2.1.01,6]dodeca-2,7-dienyl]oxy]silane (PubChem CID 135036246) has the molecular formula C19H32O2Si2 and a molecular weight of 348.64 g/mol. Its IUPAC name is trimethyl-[[(1R,6R,9R)-10-methylidene-2-trimethylsilyloxy-8-tricyclo[7.2.1.01,6]dodeca-2,7-dienyl]oxy]silane.
| Compound Name | trimethyl-[[(1R,6R,9R)-10-methylidene-2-trimethylsilyloxy-8-tricyclo[7.2.1.01,6]dodeca-2,7-dienyl]oxy]silane |
|---|---|
| PubChem CID | 135036246 |
| Molecular Formula | C19H32O2Si2 |
| Molecular Weight | 348.64 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | trimethyl-[[(1R,6R,9R)-10-methylidene-2-trimethylsilyloxy-8-tricyclo[7.2.1.01,6]dodeca-2,7-dienyl]oxy]silane |
| SMILES | C=C1C[C@]23C[C@H]1C(O[Si](C)(C)C)=C[C@H]2CCC=C3O[Si](C)(C)C |
| InChI | InChI=1S/C19H32O2Si2/c1-14-12-19-13-16(14)17(20-22(2,3)4)11-15(19)9-8-10-18(19)21-23(5,6)7/h10-11,15-16H,1,8-9,12-13H2,2-7H3/t15-,16-,19+/m1/s1 |
| InChIKey | CXSHRNYDLSYJTN-MDZRGWNJSA-N |
| XLogP | 5.83 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.64 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|