C12H11BrN2O5 — CID 135036651
dimethyl (4R,5R)-3-(2-bromo-3-pyridinyl)-4,5-dihydro-1,2-oxazole-4,5-dicarboxylate (PubChem CID 135036651) has the molecular formula C12H11BrN2O5 and a molecular weight of 343.13 g/mol. Its IUPAC name is dimethyl (4R,5R)-3-(2-bromo-3-pyridinyl)-4,5-dihydro-1,2-oxazole-4,5-dicarboxylate.
| Compound Name | dimethyl (4R,5R)-3-(2-bromo-3-pyridinyl)-4,5-dihydro-1,2-oxazole-4,5-dicarboxylate |
|---|---|
| PubChem CID | 135036651 |
| Molecular Formula | C12H11BrN2O5 |
| Molecular Weight | 343.13 g/mol |
| Exact Mass | 341.99 |
| IUPAC Name | dimethyl (4R,5R)-3-(2-bromo-3-pyridinyl)-4,5-dihydro-1,2-oxazole-4,5-dicarboxylate |
| SMILES | COC(=O)[C@@H]1C(c2cccnc2Br)=NO[C@H]1C(=O)OC |
| InChI | InChI=1S/C12H11BrN2O5/c1-18-11(16)7-8(6-4-3-5-14-10(6)13)15-20-9(7)12(17)19-2/h3-5,7,9H,1-2H3/t7-,9-/m1/s1 |
| InChIKey | HNDWZOGMSFSFRS-VXNVDRBHSA-N |
| XLogP | 0.91 |
| TPSA | 87.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.13 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|