C13H22O — CID 135036759
1-[(2R,5S)-2,5-bis(ethenyl)-1-methylcyclopentyl]propan-2-ol (PubChem CID 135036759) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is 1-[(2R,5S)-2,5-bis(ethenyl)-1-methylcyclopentyl]propan-2-ol.
| Compound Name | 1-[(2R,5S)-2,5-bis(ethenyl)-1-methylcyclopentyl]propan-2-ol |
|---|---|
| PubChem CID | 135036759 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | 1-[(2R,5S)-2,5-bis(ethenyl)-1-methylcyclopentyl]propan-2-ol |
| SMILES | C=C[C@@H]1CC[C@H](C=C)C1(C)CC(C)O |
| InChI | InChI=1S/C13H22O/c1-5-11-7-8-12(6-2)13(11,4)9-10(3)14/h5-6,10-12,14H,1-2,7-9H2,3-4H3/t10?,11-,12+,13? |
| InChIKey | MQTYMKXPWYTCJE-UNTZMWQOSA-N |
| XLogP | 3.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|