C13H22O — CID 14608168
[(3aS,6aR)-1-ethenyl-5,5-dimethyl-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]methanol (PubChem CID 14608168) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is [(3aS,6aR)-1-ethenyl-5,5-dimethyl-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]methanol.
| Compound Name | [(3aS,6aR)-1-ethenyl-5,5-dimethyl-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]methanol |
|---|---|
| PubChem CID | 14608168 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | [(3aS,6aR)-1-ethenyl-5,5-dimethyl-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]methanol |
| SMILES | C=CC1C(CO)C[C@H]2CC(C)(C)C[C@@H]12 |
| InChI | InChI=1S/C13H22O/c1-4-11-10(8-14)5-9-6-13(2,3)7-12(9)11/h4,9-12,14H,1,5-8H2,2-3H3/t9-,10?,11?,12+/m0/s1 |
| InChIKey | SELGYUFHWLYJNJ-WNYYMSAVSA-N |
| XLogP | 2.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|