C15H24O — CID 162907653
[(1R,2R,5S,7S)-6,6,8-trimethyl-2-tricyclo[5.3.1.01,5]undec-8-enyl]methanol (PubChem CID 162907653) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is [(1R,2R,5S,7S)-6,6,8-trimethyl-2-tricyclo[5.3.1.01,5]undec-8-enyl]methanol.
| Compound Name | [(1R,2R,5S,7S)-6,6,8-trimethyl-2-tricyclo[5.3.1.01,5]undec-8-enyl]methanol |
|---|---|
| PubChem CID | 162907653 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | [(1R,2R,5S,7S)-6,6,8-trimethyl-2-tricyclo[5.3.1.01,5]undec-8-enyl]methanol |
| SMILES | CC1=CC[C@@]23C[C@@H]1C(C)(C)[C@@H]2CC[C@H]3CO |
| InChI | InChI=1S/C15H24O/c1-10-6-7-15-8-12(10)14(2,3)13(15)5-4-11(15)9-16/h6,11-13,16H,4-5,7-9H2,1-3H3/t11-,12-,13-,15-/m0/s1 |
| InChIKey | SNPNUENVUPIHQQ-ABHRYQDASA-N |
| XLogP | 3.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|