C16H11NO3S — CID 1350369
(5Z)-5-[(3-phenoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 1350369) has the molecular formula C16H11NO3S and a molecular weight of 297.34 g/mol. Its IUPAC name is (5Z)-5-[(3-phenoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[(3-phenoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 1350369 |
| Molecular Formula | C16H11NO3S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | (5Z)-5-[(3-phenoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1NC(=O)/C(=C/c2cccc(Oc3ccccc3)c2)S1 |
| InChI | InChI=1S/C16H11NO3S/c18-15-14(21-16(19)17-15)10-11-5-4-8-13(9-11)20-12-6-2-1-3-7-12/h1-10H,(H,17,18,19)/b14-10- |
| InChIKey | KUGWAQWUAGDMPL-UVTDQMKNSA-N |
| XLogP | 3.80 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|