C16H16O2 — CID 135036976
4-phenyl-6-[(E)-prop-1-enyl]-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one (PubChem CID 135036976) has the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. Its IUPAC name is 4-phenyl-6-[(E)-prop-1-enyl]-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one.
| Compound Name | 4-phenyl-6-[(E)-prop-1-enyl]-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one |
|---|---|
| PubChem CID | 135036976 |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 4-phenyl-6-[(E)-prop-1-enyl]-1,3,6,6a-tetrahydrocyclopenta[c]furan-5-one |
| SMILES | C/C=C/C1C(=O)C(c2ccccc2)=C2COCC21 |
| InChI | InChI=1S/C16H16O2/c1-2-6-12-13-9-18-10-14(13)15(16(12)17)11-7-4-3-5-8-11/h2-8,12-13H,9-10H2,1H3/b6-2+ |
| InChIKey | KMOPFLORBWAYGA-QHHAFSJGSA-N |
| XLogP | 2.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|