C13H15N3O2 — CID 135037101
2,2,6-trimethyl-7-oxo-1-phenyl-4,6-diaza-3-azoniaspiro[2.4]hept-4-en-5-olate (PubChem CID 135037101) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is 2,2,6-trimethyl-7-oxo-1-phenyl-4,6-diaza-3-azoniaspiro[2.4]hept-4-en-5-olate.
| Compound Name | 2,2,6-trimethyl-7-oxo-1-phenyl-4,6-diaza-3-azoniaspiro[2.4]hept-4-en-5-olate |
|---|---|
| PubChem CID | 135037101 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 2,2,6-trimethyl-7-oxo-1-phenyl-4,6-diaza-3-azoniaspiro[2.4]hept-4-en-5-olate |
| SMILES | CN1C(=O)[N+]2(N=C1[O-])C(c1ccccc1)C2(C)C |
| InChI | InChI=1S/C13H15N3O2/c1-13(2)10(9-7-5-4-6-8-9)16(13)12(18)15(3)11(17)14-16/h4-8,10H,1-3H3 |
| InChIKey | HMRTZVSGAFCYBK-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|