About (2S)-2-methoxybut-3-enal;yttrium
(2S)-2-methoxybut-3-enal;yttrium (PubChem CID 135037126) has the molecular formula C5H7O2Y-
and a molecular weight of 188.02 g/mol. Its IUPAC name is (2S)-2-methoxybut-3-enal;yttrium.
Molecular Properties
| Compound Name | (2S)-2-methoxybut-3-enal;yttrium |
| PubChem CID | 135037126 |
| Molecular Formula | C5H7O2Y- |
| Molecular Weight | 188.02 g/mol |
| Exact Mass | 187.95 |
| IUPAC Name | (2S)-2-methoxybut-3-enal;yttrium |
| SMILES | [H]/[C-]=C\[C@@H](C=O)OC.[Y] |
| InChI | InChI=1S/C5H7O2.Y/c1-3-5(4-6)7-2;/h1,3-5H,2H3;/q-1;/t5-;/m0./s1 |
| InChIKey | RYLGEOOXPAVFCW-JEDNCBNOSA-N |
| XLogP | 0.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.02 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-methoxybut-3-enal;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-methoxybut-3-enal;yttrium?
The IUPAC name of (2S)-2-methoxybut-3-enal;yttrium (CID 135037126) is (2S)-2-methoxybut-3-enal;yttrium.
What is the SMILES notation for (2S)-2-methoxybut-3-enal;yttrium?
The canonical SMILES for (2S)-2-methoxybut-3-enal;yttrium is [H]/[C-]=C\[C@@H](C=O)OC.[Y].
What is the InChIKey of (2S)-2-methoxybut-3-enal;yttrium?
The InChIKey is RYLGEOOXPAVFCW-JEDNCBNOSA-N. The full InChI is InChI=1S/C5H7O2.Y/c1-3-5(4-6)7-2;/h1,3-5H,2H3;/q-1;/t5-;/m0./s1.
What are the key properties of (2S)-2-methoxybut-3-enal;yttrium?
(2S)-2-methoxybut-3-enal;yttrium has a molecular weight of 188.02 g/mol, XLogP of 0.19, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-methoxybut-3-enal;yttrium is sourced from PubChem (CID 135037126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).