C15H24O3 — CID 135037163
methyl (4aR,8aR)-2-hydroxy-4a,7,7-trimethyl-3,4,5,6,8,8a-hexahydronaphthalene-1-carboxylate (PubChem CID 135037163) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is methyl (4aR,8aR)-2-hydroxy-4a,7,7-trimethyl-3,4,5,6,8,8a-hexahydronaphthalene-1-carboxylate.
| Compound Name | methyl (4aR,8aR)-2-hydroxy-4a,7,7-trimethyl-3,4,5,6,8,8a-hexahydronaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 135037163 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | methyl (4aR,8aR)-2-hydroxy-4a,7,7-trimethyl-3,4,5,6,8,8a-hexahydronaphthalene-1-carboxylate |
| SMILES | COC(=O)C1=C(O)CC[C@@]2(C)CCC(C)(C)C[C@@H]12 |
| InChI | InChI=1S/C15H24O3/c1-14(2)7-8-15(3)6-5-11(16)12(10(15)9-14)13(17)18-4/h10,16H,5-9H2,1-4H3/t10-,15-/m0/s1 |
| InChIKey | NAOFFZRAJDRHIU-BONVTDFDSA-N |
| XLogP | 3.60 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |