C22H19NO4 — CID 135037930
methyl (1S,10S,12R)-2-benzyl-3-oxo-15-oxa-2-azatetracyclo[10.2.1.01,10.04,9]pentadeca-4,6,8,13-tetraene-10-carboxylate (PubChem CID 135037930) has the molecular formula C22H19NO4 and a molecular weight of 361.40 g/mol. Its IUPAC name is methyl (1S,10S,12R)-2-benzyl-3-oxo-15-oxa-2-azatetracyclo[10.2.1.01,10.04,9]pentadeca-4,6,8,13-tetraene-10-carboxylate.
| Compound Name | methyl (1S,10S,12R)-2-benzyl-3-oxo-15-oxa-2-azatetracyclo[10.2.1.01,10.04,9]pentadeca-4,6,8,13-tetraene-10-carboxylate |
|---|---|
| PubChem CID | 135037930 |
| Molecular Formula | C22H19NO4 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | methyl (1S,10S,12R)-2-benzyl-3-oxo-15-oxa-2-azatetracyclo[10.2.1.01,10.04,9]pentadeca-4,6,8,13-tetraene-10-carboxylate |
| SMILES | COC(=O)[C@]12C[C@@H]3C=C[C@@]1(O3)N(Cc1ccccc1)C(=O)c1ccccc12 |
| InChI | InChI=1S/C22H19NO4/c1-26-20(25)21-13-16-11-12-22(21,27-16)23(14-15-7-3-2-4-8-15)19(24)17-9-5-6-10-18(17)21/h2-12,16H,13-14H2,1H3/t16-,21+,22-/m0/s1 |
| InChIKey | IYSNPWMVSKZHTC-USCONSEESA-N |
| XLogP | 2.81 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|